CAS 6455-94-3
:2-[(3-fluorobenzyl)oxy]benzaldehyde
Description:
2-[(3-Fluorobenzyl)oxy]benzaldehyde, with the CAS number 6455-94-3, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a fluorobenzyl ether moiety. This compound features a fluorine atom substituted on the benzyl ring, which can influence its reactivity and physical properties, such as polarity and solubility. Typically, compounds like this exhibit moderate to high lipophilicity due to their aromatic nature, making them soluble in organic solvents while being less soluble in water. The presence of the aldehyde group contributes to its potential reactivity, particularly in nucleophilic addition reactions. Additionally, the fluorine substitution can enhance the compound's stability and alter its electronic properties, which may be beneficial in various chemical applications, including medicinal chemistry and material science. Overall, 2-[(3-fluorobenzyl)oxy]benzaldehyde is a versatile compound with potential uses in synthesis and as an intermediate in the production of more complex molecules.
Formula:C14H11FO2
InChI:InChI=1/C14H11FO2/c15-13-6-3-4-11(8-13)10-17-14-7-2-1-5-12(14)9-16/h1-9H,10H2
SMILES:c1ccc(c(c1)C=O)OCc1cccc(c1)F
Synonyms:- Benzaldehyde, 2-[(3-fluorophenyl)methoxy]-
- 2-[(3-Fluorobenzyl)oxy]benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.