CAS 64559-06-4
:3-methoxybenzenecarbothioamide
Description:
3-Methoxybenzenecarbothioamide, with the CAS number 64559-06-4, is an organic compound characterized by the presence of a methoxy group (-OCH3) and a carbothioamide functional group (-C(S)NH2) attached to a benzene ring. This compound typically exhibits properties associated with both aromatic and thioamide functionalities. The methoxy group contributes to the compound's solubility in organic solvents and can influence its reactivity and interaction with other chemical species. The thioamide group is known for its potential biological activity and can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The presence of the aromatic ring provides stability and can affect the compound's electronic properties. Overall, 3-methoxybenzenecarbothioamide may be of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C8H9NOS
InChI:InChI=1/C8H9NOS/c1-10-7-4-2-3-6(5-7)8(9)11/h2-5H,1H3,(H2,9,11)
SMILES:COc1cccc(c1)C(=N)S
Synonyms:- Benzenecarbothioamide, 3-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Methoxythiobenzamide, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H9NOSPurity:97%Color and Shape:Yellow, Crystals or powder or crystalline powderMolecular weight:167.233-methoxythio Benzamide
CAS:3-methoxythio Benzamide, a synthetic pharma intermediate, is a potent liver toxin.Formula:C8H9NOSColor and Shape:SolidMolecular weight:167.233-Methoxybenzenecarbothioamide
CAS:3-MethoxybenzenecarbothioamidePurity:98%Molecular weight:167.23g/mol




