CAS 6456-78-6

6-Chloro-8-quinolinecarboxylic acid

Description:

6-Chloro-8-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a carboxylic acid group (-COOH) at the 8-position and a chlorine atom at the 6-position contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid functionality. It exhibits acidic behavior, capable of donating protons in solution. The chlorine substituent can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, 6-Chloro-8-quinolinecarboxylic acid may participate in various chemical reactions, including esterification and amidation, allowing for the synthesis of derivatives with potential therapeutic applications. Its structural features also suggest potential interactions with biological targets, which can be explored in pharmacological studies. Overall, this compound serves as a valuable building block in organic synthesis and medicinal chemistry.

Formula: C₁₀H₆ClNO₂

InChI: InChI=1/C10H6ClNO2/c11-7-4-6-2-1-3-12-9(6)8(5-7)10(13)14/h1-5H,(H,13,14)

SMILES: c1cc2cc(cc(c2nc1)C(=O)O)Cl

Synonyms:

• 6-Chloroquinoline-8-carboxylicacid
• 6-Chloroquinoline-8-Carboxylic Acid

6-Chloroquinoline-8-carboxylic acid

CAS: 6456-78-6

Formula: C₁₀H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 207.6131

Ref: IN-DA00EEMM

6-Chloroquinoline-8-carboxylic acid

CAS: 6456-78-6

6-Chloroquinoline-8-carboxylic acid

Purity: 97%

Molecular weight: 207.62g/mol

Ref: 54-OR73077

6-Chloroquinoline-8-carboxylic acid

CAS: 6456-78-6

Formula: C₁₀H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 207.61

Ref: 10-F077409

6-Chloro-8-quinolinecarboxylic Acid

Controlled Product

CAS: 6456-78-6

Applications A 6-substituted 8-quinolinecarboxylic acid as antimicrobial and genotoxic agent.
References Weyer, R., et al.: Arzneim.-Forsch., 24, 269 (1974),

Formula: C₁₀H₆ClNO₂

Color and Shape: Neat

Molecular weight: 207.61

Ref: TR-C379910