CAS 64574-24-9
:1-(1H-Benzimidazol-4-yl)methanamine
Description:
1-(1H-Benzimidazol-4-yl)methanamine, with the CAS number 64574-24-9, is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amine functional group. The amine group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. It may also exhibit basic properties due to the nitrogen atom in the amine group. The benzimidazole moiety is known for its biological activity, often serving as a scaffold in pharmaceuticals, which may suggest that this compound could have potential applications in medicinal chemistry. Additionally, its structural features may allow for various modifications, making it a versatile compound for further research and development in chemical and biological contexts.
Formula:C8H9N3
InChI:InChI=1/C8H9N3/c9-4-6-2-1-3-7-8(6)11-5-10-7/h1-3,5H,4,9H2,(H,10,11)
SMILES:c1cc(CN)c2c(c1)nc[nH]2
Synonyms:- 1-(1H-Benzimidazol-7-yl)methanamine
- 1H-Benzimidazole-4-methanamine
- 1H-benzimidazole-7-methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(1H-Benzimidazol-4-yl)methanamine hydrochloride
CAS:1-(1H-Benzimidazol-4-yl)methanamine hydrochloride is a versatile building block that can be used as a research chemical, reaction component, or a speciality chemical. It is a fine chemical with high purity and quality. This compound can be used as a useful scaffold for the preparation of other compounds, including pharmaceuticals and agrochemicals. 1-(1H-Benzimidazol-4-yl)methanamine hydrochloride is an intermediate in organic synthesis reactions that are used to synthesize other organic compounds.Formula:C8H8N3·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:182.63 g/mol

