CAS 64579-67-5

cyclobutyl(piperazin-1-yl)methanone

Description:

Cyclobutyl(piperazin-1-yl)methanone is a chemical compound characterized by its unique structure, which includes a cyclobutyl group and a piperazine moiety linked to a carbonyl functional group. This compound typically exhibits properties associated with both cyclic and heterocyclic compounds, including potential for diverse reactivity due to the presence of the carbonyl group. The cyclobutyl ring contributes to its rigidity and may influence its conformational behavior, while the piperazine ring can enhance solubility in polar solvents and may participate in hydrogen bonding interactions. Cyclobutyl(piperazin-1-yl)methanone may also exhibit biological activity, making it of interest in medicinal chemistry for potential therapeutic applications. Its molecular interactions, stability, and reactivity can be influenced by the steric and electronic effects of the substituents on the rings. Overall, this compound represents a fascinating example of how structural features can dictate the chemical and biological properties of a substance.

Formula: C₉H₁₆N₂O

InChI: InChI=1/C9H16N2O/c12-9(8-2-1-3-8)11-6-4-10-5-7-11/h8,10H,1-7H2

SMILES: C1CC(C1)C(=O)N1CCNCC1

Synonyms:

• 1-(Cyclobutylcarbonyl)Piperazine

cyclobutyl(piperazin-1-yl)methanone

CAS: 64579-67-5

Versatile small molecule scaffold

Formula: C₉H₁₆N₂O

Purity: Min. 95%

Molecular weight: 168.24 g/mol

Ref: 3D-PCA57967