CAS 64599-56-0
:(R)-1-phenyl-2-propyn-1-ol
Description:
(R)-1-phenyl-2-propyn-1-ol, with the CAS number 64599-56-0, is an organic compound characterized by its alkyne functional group and a hydroxyl group. This compound features a phenyl group attached to a propyne structure, which contributes to its unique reactivity and properties. It is typically a colorless to pale yellow liquid with a distinct aromatic odor. The presence of the hydroxyl group makes it an alcohol, allowing for hydrogen bonding, which can influence its solubility in polar solvents. The compound exhibits chirality, with the (R) configuration indicating the specific spatial arrangement of its atoms, which can affect its biological activity and interactions. It is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or other organic compounds. Due to its alkyne nature, it can participate in various reactions, including nucleophilic additions and coupling reactions, making it a valuable building block in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks.
Formula:C9H8O
InChI:InChI=1/C9H8O/c1-2-9(10)8-6-4-3-5-7-8/h1,3-7,9-10H/t9-/m0/s1
SMILES:C#C[C@@H](c1ccccc1)O
Synonyms:- (1S)-1-phenylprop-2-yn-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-1-phenylprop-2-yn-1-ol
CAS:Formula:C9H8OPurity:95%Color and Shape:LiquidMolecular weight:132.1592(S)-1-Phenyl-2-propyn-1-ol
CAS:<p>(S)-1-phenyl-2-propyn-1-ol is a bicyclic compound that is used in the metathesis reaction. This chemical can undergo a metathesis reaction, where two different types of bonds are broken and two new ones are formed. (S)-1-Phenyl-2-propyn-1-ol can be used for the synthesis of polymers, pharmaceuticals, and agrochemicals.</p>Formula:C9H8OPurity:Min. 95%Molecular weight:132.16 g/mol



