CAS 64616-76-8
:Ro 04-1419
Description:
Ro 04-1419, with the CAS number 64616-76-8, is a chemical compound that belongs to the class of selective serotonin reuptake inhibitors (SSRIs). It is primarily studied for its potential effects on serotonin levels in the brain, which can influence mood and behavior. This compound has been investigated for its possible applications in treating various psychiatric disorders, including depression and anxiety. Ro 04-1419 exhibits a specific mechanism of action that involves the inhibition of serotonin transporters, thereby increasing the availability of serotonin in the synaptic cleft. In terms of its physical properties, Ro 04-1419 is typically characterized by its molecular structure, which includes specific functional groups that contribute to its pharmacological activity. As with many compounds in this class, safety and efficacy profiles are critical, and ongoing research continues to explore its therapeutic potential and side effects. However, detailed information regarding its pharmacokinetics, toxicity, and clinical applications may vary and should be consulted from specialized literature or databases.
Formula:C3H9N3O2
InChI:InChI=1S/C3H9N3O2/c4-2(1-7)3(8)6-5/h2,7H,1,4-5H2,(H,6,8)
InChI key:InChIKey=YTHVXUGXVASXJZ-UHFFFAOYSA-N
SMILES:C(C(NN)=O)(CO)N
Synonyms:- DL-Serine, hydrazide
- Ro 04-1419
- Serine, hydrazide
- 2-Amino-3-hydroxypropanehydrazide
- 2-Amino-3-hydroxypropanehydrazide (non-preferred name)
- (RS)-2-Amino-3-hydroxypropanohydrazide
- 2-Amino-3-hydroxypropanehydrazide(non-preferredname)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
