CAS 64638-15-9
:3',5'-diamino-3',5'-dideoxythymidine
Description:
3',5'-Diamino-3',5'-dideoxythymidine, also known by its CAS number 64638-15-9, is a synthetic nucleoside analog of thymidine. This compound is characterized by the presence of two amino groups at the 3' and 5' positions of the sugar moiety, which replaces the hydroxyl groups typically found in natural nucleosides. As a dideoxynucleoside, it lacks the hydroxyl group at the 2' position of the ribose sugar, which is crucial for DNA chain elongation, making it a potential inhibitor of DNA polymerases. This structural modification imparts unique biochemical properties, allowing it to interfere with DNA synthesis and replication processes. 3',5'-Diamino-3',5'-dideoxythymidine has been studied for its antiviral and anticancer activities, as it may exhibit efficacy against certain viral infections and tumor cells by disrupting nucleic acid synthesis. Its solubility, stability, and interaction with biological targets are key factors influencing its pharmacological potential. Further research is necessary to fully elucidate its mechanisms of action and therapeutic applications.
Formula:C10H16N4O3
InChI:InChI=1/C10H16N4O3/c1-5-4-14(10(16)13-9(5)15)8-2-6(12)7(3-11)17-8/h4,6-8H,2-3,11-12H2,1H3,(H,13,15,16)/t6-,7+,8+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3',5'-Diamino- 3', 5'- dideoxythymidine
CAS:3',5'-Diamino-3',5'-dideoxythymidine (ddT) is a cytosine analog that inhibits the growth of cells by interfering with DNA replication. This drug is effective against viruses such as herpes, which are dependent on deoxycytidine for replication. 3',5'-Diamino-3',5'-dideoxythymidine binds to the viral DNA and prevents it from being used as a template for viral RNA synthesis. It also has potent antiviral activity against l1210 and uninfected mice. 3',5'-Diamino-3',5'-dideoxythymidine is not charged and does not penetrate tissues well because of its large size. It also has limited effects on bacterial enzymes.Formula:C10H16N4O3Purity:Min. 95%Molecular weight:240.26 g/mol
