CAS 646455-90-5

1-(3-bromopropanoyl)-4-[5-(trifluoromethyl)pyridin-2-yl]-1,4-diazepane

Description:

1-(3-Bromopropanoyl)-4-[5-(trifluoromethyl)pyridin-2-yl]-1,4-diazepane is a chemical compound characterized by its complex structure, which includes a diazepane ring, a bromopropanoyl group, and a pyridine moiety with a trifluoromethyl substituent. The presence of the diazepane ring, a seven-membered cyclic compound containing two nitrogen atoms, contributes to its potential biological activity and pharmacological properties. The bromopropanoyl group introduces a reactive site that may participate in various chemical reactions, while the trifluoromethyl group enhances lipophilicity and can influence the compound's interaction with biological targets. This compound may exhibit unique solubility and stability characteristics due to its diverse functional groups. Additionally, the presence of halogens and heteroatoms can affect its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, the structural features of this compound suggest it may have interesting properties worthy of further investigation in chemical and biological contexts.

Formula: C₁₄H₁₇BrF₃N₃O

InChI: InChI=1/C14H17BrF3N3O/c15-5-4-13(22)21-7-1-6-20(8-9-21)12-3-2-11(10-19-12)14(16,17)18/h2-3,10H,1,4-9H2

SMILES: C1CN(CCN(C1)C(=O)CCBr)c1ccc(cn1)C(F)(F)F

Synonyms:

• 1-propanone, 3-bromo-1-[hexahydro-4-[5-(trifluoromethyl)-2-pyridinyl]-1H-1,4-diazepin-1-yl]-
• 3-Bromo-1-{4-[5-(trifluoromethyl)pyridin-2-yl]-1,4-diazepan-1-yl}propan-1-one

3-Bromo-1-{4-[5-(trifluoromethyl)pyridin-2-yl]homopiperazin-1-yl}propan-1-one

CAS: 646455-90-5

3-Bromo-1-{4-[5-(trifluoromethyl)pyridin-2-yl]homopiperazin-1-yl}propan-1-one

Purity: ≥95%

Molecular weight: 380.20g/mol

Ref: 54-PC31143