CAS 6466-43-9

8-[(benzylsulfanyl)methyl]-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione

Description:

The chemical substance known as 8-[(benzylsulfanyl)methyl]-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, with the CAS number 6466-43-9, is a purine derivative that exhibits characteristics typical of compounds in this class. It features a purine core structure, which is characterized by a fused double-ring system containing nitrogen atoms. The presence of a benzylsulfanyl group introduces a sulfur atom into the molecular structure, which can influence the compound's reactivity and solubility. The dimethyl groups at positions 1 and 3 suggest that the compound may exhibit specific steric and electronic properties, potentially affecting its biological activity. This compound may be of interest in medicinal chemistry due to its structural similarity to nucleobases, which are essential in biological systems. Its potential applications could include roles as a pharmacological agent or in biochemical research. However, detailed studies would be necessary to fully elucidate its properties, including solubility, stability, and biological activity.

Formula: C₁₅H₁₆N₄O₂S

InChI: InChI=1/C15H16N4O2S/c1-18-13-12(14(20)19(2)15(18)21)16-11(17-13)9-22-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,16,17)

SMILES: Cn1c2c(c(=O)n(C)c1=O)nc(CSCc1ccccc1)[nH]2

TPBM

CAS: 6466-43-9

Formula: C₁₅H₁₆N₄O₂S

Molecular weight: 316.38

Ref: 7W-GL9805

TPBM

CAS: 6466-43-9

TPBM inhibits ERα, non-toxic, blocks E2-ERα gene binding, halts ERα+ cancer cell growth (IC50: 5-9 μM), no effect on estrogen-independent growth.

Formula: C₁₅H₁₆N₄O₂S

Color and Shape: Solid

Molecular weight: 316.38

Ref: TM-T60827