
CAS 6466-67-7
:Psilostachyin C
Description:
Psilostachyin C, with the CAS number 6466-67-7, is a naturally occurring chemical compound classified as a sesquiterpene. It is primarily derived from certain species of fungi, particularly those in the genus Psilocybe, which are known for their psychoactive properties. This compound is characterized by its complex molecular structure, which contributes to its biological activity. Psilostachyin C exhibits potential pharmacological effects, including anti-inflammatory and antimicrobial properties, although research on its specific mechanisms and applications is still ongoing. The compound is typically found in trace amounts within its natural sources, making its extraction and study challenging. Its stability and solubility characteristics can vary depending on environmental conditions, which may influence its bioavailability and efficacy. As with many natural products, the exploration of Psilostachyin C may offer insights into novel therapeutic agents, particularly in the fields of medicine and pharmacology. However, further studies are necessary to fully understand its properties and potential uses.
Formula:C15H20O4
InChI:InChI=1S/C15H20O4/c1-8-4-5-10-9(2)14(17)18-13(10)15(3)11(8)6-7-12(16)19-15/h8,10-11,13H,2,4-7H2,1,3H3/t8-,10-,11-,13+,15+/m0/s1
InChI key:InChIKey=FZYIWDQVFMUXPW-OEAYZANCSA-N
SMILES:C[C@]12[C@]3([C@](C(=C)C(=O)O3)(CC[C@H](C)[C@@]1(CCC(=O)O2)[H])[H])[H]
Synonyms:- Furo[3′,2′:6,7]cyclohepta[1,2-b]pyran-2,9-dione, decahydro-6,10a-dimethyl-3-methylene-, [3aS-(3aα,6β,6aα,10aβ,10bα)]-
- Furo[3′,2′:6,7]cyclohepta[1,2-b]pyran-2,9-dione, decahydro-6,10a-dimethyl-3-methylene-, (3aS,6S,6aS,10aR,10bR)-
- Psilostachyin C
- NSC 106392
- (3aS,6S,6aS,10aR,10bR)-Decahydro-6,10a-dimethyl-3-methylenefuro[3′,2′:6,7]cyclohepta[1,2-b]pyran-2,9-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Psilostachyin C
CAS:Psilostachyin C: a nearly water-insoluble, neutral sesquiterpene lactone from Ambrosia, in mugwort; possible consumption biomarker.Formula:C15H20O4Color and Shape:SolidMolecular weight:264.32
