CAS 6468-96-8
:3-phenylumbelliferone
Description:
3-Phenylumbelliferone, also known as 7-hydroxy-4-phenylcoumarin, is a chemical compound belonging to the coumarin family. It is characterized by its distinct structure, which includes a coumarin backbone with a phenyl group attached at the 3-position. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in medicinal chemistry and pharmacology. 3-Phenylumbelliferone is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but its solubility in water is limited. The compound can be synthesized through various methods, often involving the condensation of appropriate phenolic and carbonyl precursors. Its fluorescence properties are also notable, as it can be used as a fluorescent probe in biochemical assays. Additionally, 3-phenylumbelliferone has been studied for its role in inhibiting certain enzymes, such as hyaluronidase, which may have implications in therapeutic applications. Overall, its unique chemical properties and biological activities make it a valuable compound in research and potential drug development.
Formula:C15H10O3
InChI:InChI=1/C15H10O3/c16-12-7-6-11-8-13(10-4-2-1-3-5-10)15(17)18-14(11)9-12/h1-9,16H
SMILES:c1ccc(cc1)c1cc2ccc(cc2oc1=O)O
Synonyms:- 7-hydroxy-3-phenyl-2H-chromen-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Phenylumbelliferone
CAS:Formula:C15H10O3Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:238.243-Phenylumbelliferone
CAS:3-Phenylumbelliferone is a coumarin derivative that is used as an antidiabetic drug. It is a competitive inhibitor of the enzyme phosphatase, which inactivates tyrosine kinase, and inhibits the formation of DOPA from L-tyrosine, resulting in inhibition of glucose uptake by cells. 3-Phenylumbelliferone also fluoresces at wavelengths of 340 nm when excited with ultraviolet light. This property has been shown to be helpful in the detection of phenylurea herbicides, polycyclic aromatic hydrocarbons, and other compounds.
Formula:C15H10O3Purity:Min. 95%Molecular weight:238.24 g/mol





