CAS 6469-36-9

5-(3-Chloropropyl)-4-methylthiazole

Description:

5-(3-Chloropropyl)-4-methylthiazole, with the CAS number 6469-36-9, is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a chloropropyl group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the methyl group on the thiazole ring influences its physical and chemical properties, such as solubility and boiling point. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The chloropropyl substituent can enhance lipophilicity, potentially affecting the compound's interaction with biological membranes. Additionally, the thiazole moiety is known for its role in various biological systems and can be involved in coordination chemistry. Overall, 5-(3-Chloropropyl)-4-methylthiazole is a compound of interest in both synthetic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₇H₁₀ClNS

InChI: InChI=1S/C7H10ClNS/c1-6-7(3-2-4-8)10-5-9-6/h5H,2-4H2,1H3

InChI key: InChIKey=HMKQACOWZYBTIW-UHFFFAOYSA-N

SMILES: C(CCCl)C1=C(C)N=CS1

Synonyms:

• Thiazole, 5-(3-chloropropyl)-4-methyl-
• Cloprothiazole
• 5-(3-Chloropropyl)-4-methylthiazole

5-(3-Chloropropyl)-4-methyl-1,3-thiazole

CAS: 6469-36-9

5-(3-Chloropropyl)-4-methyl-1,3-thiazole is a hydrophobic antibiotic that is used as a diluent in iontophoresis. It has been shown to have targetable properties and high concentrations when it is used in phase chromatography. 5-(3-Chloropropyl)-4-methyl-1,3-thiazole also serves as a fixative agent and can be used as a diagnostic tool for the detection of salicylic acid. This compound has been found to be insoluble at high concentrations, so it cannot be reconstituted with water.

Formula: C₇H₁₀ClNS

Purity: Min. 95%

Molecular weight: 175.68 g/mol

Ref: 3D-GAA46936