CAS 64695-78-9
:1,2-Dibromo-4,5-difluorobenzene
Description:
1,2-Dibromo-4,5-difluorobenzene is an aromatic compound characterized by the presence of two bromine atoms and two fluorine atoms attached to a benzene ring. The molecular formula for this compound is C6H2Br2F2, indicating a relatively complex halogenated structure. It typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. The presence of multiple halogen substituents significantly influences its physical and chemical properties, including its reactivity and solubility. This compound is generally non-polar due to the symmetrical arrangement of the halogens, which affects its interactions with other substances. It is often used in organic synthesis and as an intermediate in the production of various chemical products. Additionally, due to the presence of bromine and fluorine, it may exhibit unique properties such as increased stability and resistance to degradation. Safety precautions are necessary when handling this compound, as halogenated compounds can pose health and environmental risks.
Formula:C6H2Br2F2
InChI:InChI=1S/C6H2Br2F2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H
InChI key:InChIKey=JTEZQWOKRHOKDG-UHFFFAOYSA-N
SMILES:BrC1=C(Br)C=C(F)C(F)=C1
Synonyms:- 1,2-Difluoro-4,5-dibromobenzene
- 265-021-1
- Benzene, 1,2-dibromo-4,5-difluoro-
- Fr Bf De Ee
- NSC 10239
- 1,2-Dibromo-4,5-difluorobenzene
- 4,5-Difluoro-1,2-dibromobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-Dibromo-4,5-difluorobenzene
CAS:Formula:C6H2Br2F2Purity:>97.0%(GC)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:271.891,2-Dibromo-4,5-difluorobenzene, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H2Br2F2Purity:98%Color and Shape:White to pale yellow or pale brown, Crystalline or fused solid, clear as meltMolecular weight:271.891,2-Dibromo-4,5-difluorobenzene
CAS:Formula:C6H2Br2F2Purity:97%Color and Shape:SolidMolecular weight:271.88491,2-Dibromo-4,5-difluorobenzene
CAS:1,2-Dibromo-4,5-difluorobenzeneFormula:C6H2Br2F2Purity:98%Color and Shape: white to off white crystalline powderMolecular weight:271.88g/mol1,2-Dibromo-4,5-difluorobenzene
CAS:Formula:C6H2Br2F2Purity:98%Color and Shape:Low Melting SolidMolecular weight:271.887




