CAS 64695-82-5

2-bromo-4,5-difluorobenzonitrile

Description:

2-Bromo-4,5-difluorobenzonitrile is an aromatic compound characterized by the presence of a bromine atom, two fluorine atoms, and a nitrile functional group attached to a benzene ring. Its molecular structure features a benzene ring substituted at the 2-position with a bromine atom and at the 4 and 5 positions with fluorine atoms, while the nitrile group (-C≡N) is typically located at the 1-position. This compound is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of electronegative fluorine and bromine atoms contributes to its reactivity and polarity, influencing its solubility in various solvents. Additionally, the nitrile group imparts unique chemical properties, making it a valuable building block in synthetic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-bromo-4,5-difluorobenzonitrile is a significant compound in the field of organic chemistry due to its diverse applications and unique structural features.

Formula: C₇H₂BrF₂N

InChI: InChI=1/C7H2BrF2N/c8-5-2-7(10)6(9)1-4(5)3-11/h1-2H

SMILES: c1c(C#N)c(cc(c1F)F)Br

Synonyms:

• Benzonitrile, 2-Bromo-4,5-Difluoro-

2-Bromo-4,5-difluorobenzonitrile

CAS: 64695-82-5

Formula: C₇H₂BrF₂N

Purity: 98%

Color and Shape: Solid

Molecular weight: 217.9983

Ref: IN-DA003GNL

2-Bromo-4,5-difluorobenzonitrile

CAS: 64695-82-5

2-Bromo-4,5-difluorobenzonitrile

Formula: C₇H₂BrF₂N

Purity: ≥95%

Color and Shape: cream/beige crystalline powder

Molecular weight: 218.00g/mol

Ref: 54-PC1369

2-Bromo-4,5-difluorobenzonitrile

CAS: 64695-82-5

Formula: C₇H₂BrF₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 218.001

Ref: 10-F078016