CAS 64695-84-7

2-bromo-4,5-difluorobenzoic acid

Description:

2-Bromo-4,5-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two fluorine atoms on a benzene ring, specifically at the 2, 4, and 5 positions relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the aromatic ring and halogen substituents. The presence of electronegative halogens like bromine and fluorine significantly influences its chemical reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound may exhibit unique properties such as increased acidity compared to unsubstituted benzoic acids, owing to the electron-withdrawing effects of the halogen substituents. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry.

Formula: C₇H₃BrF₂O₂

InChI: InChI=1/C7H3BrF2O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12)

SMILES: c1c(c(cc(c1F)F)Br)C(=O)O

Synonyms:

• Benzoic Acid, 2-Bromo-4,5-Difluoro-

2-Bromo-4,5-difluorobenzoic Acid

CAS: 64695-84-7

Formula: C₇H₃BrF₂O₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 237.00

Ref: 3B-B5722

2-bromo-4,5-difluorobenzoic acid

CAS: 64695-84-7

Formula: C₇H₃BrF₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 236.9983

Ref: IN-DA003GNK

2-Bromo-4,5-difluorobenzoic acid

CAS: 64695-84-7

2-Bromo-4,5-difluorobenzoic acid

Formula: C₇H₃BrF₂O₂

Purity: 98%

Color and Shape: white crystalline solid

Molecular weight: 237.00g/mol

Ref: 54-PC6625

2-Bromo-4,5-difluorobenzoic acid

CAS: 64695-84-7

Formula: C₇H₃BrF₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 237

Ref: 10-F092951