CAS 64700-15-8
:7-(carboxymethoxy)-4-methylcoumarin
Description:
7-(Carboxymethoxy)-4-methylcoumarin, identified by its CAS number 64700-15-8, is a synthetic organic compound belonging to the coumarin family, which is characterized by a benzopyrone structure. This compound features a carboxymethoxy group at the 7-position and a methyl group at the 4-position of the coumarin ring, contributing to its unique chemical properties. It is typically a yellow to orange crystalline solid, exhibiting fluorescence, which makes it useful in various applications, including as a fluorescent probe in biochemical assays. The presence of the carboxymethoxy group enhances its solubility in polar solvents, while the methyl group can influence its reactivity and stability. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and research. Its synthesis often involves the reaction of appropriate coumarin derivatives with carboxymethylating agents. As with many coumarins, it may possess antioxidant properties, although specific biological activities would require further investigation.
Formula:C12H9O5
InChI:InChI=1/C12H10O5/c1-7-4-12(15)17-10-5-8(2-3-9(7)10)16-6-11(13)14/h2-5H,6H2,1H3,(H,13,14)/p-1
SMILES:Cc1cc(=O)oc2cc(ccc12)OCC(=O)[O-]
Synonyms:- [(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetic acid
- [(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-(Carboxymethoxy)-4-methylcoumarin
CAS:Formula:C12H10O5Purity:95%Color and Shape:SolidMolecular weight:234.20482-((4-Methyl-2-Oxo-2H-Chromen-7-Yl)Oxy)Acetic Acid
CAS:2-((4-Methyl-2-Oxo-2H-Chromen-7-Yl)Oxy)Acetic AcidPurity:99%Molecular weight:234.2g/mol[(4-Methyl-2-oxo-2H-chromen-7-yl)oxy]acetic acid
CAS:[(4-Methyl-2-oxo-2H-chromen-7-yl)oxy]acetic acid is a potential use for the production of iron oxide particles used in microscopy. It is synthesized by reacting 4-methylcoumarin with acetic anhydride. The reaction product is then purified by gel permeation chromatography, which separates it from other components and chloride salts. This compound can be used as a starting material for cellulose derivatives and trimethylammonium chloride. [(4-Methyl-2-oxo-2H-chromen-7-yl)oxy]acetic acid is not soluble in water or organic solvents such as acetonitrile, but it can be dissolved in a mixture of both to produce a textured product that has iminium groups on its fatty acid ester chains. This material can also be used to synthesize 2-[(4,6 -dimethoxybenzoFormula:C12H10O5Purity:Min. 95%Color and Shape:PowderMolecular weight:234.2 g/mol(4-Methyl-2-oxo-2H-chromen-7-yloxy)-acetic acid
CAS:Formula:C12H10O5Purity:95%Molecular weight:234.207



