CAS 64701-47-9
:1-pyrenedecanoic acid
Description:
1-Pyrenedecanoic acid is an organic compound characterized by its long hydrocarbon chain and a pyrene moiety, which is a polycyclic aromatic hydrocarbon. This compound features a decanoic acid functional group, consisting of a ten-carbon aliphatic chain terminating in a carboxylic acid group, attached to a pyrene structure. The presence of the pyrene unit imparts unique optical and electronic properties, making it of interest in various applications, including materials science and nanotechnology. 1-Pyrenedecanoic acid is typically a solid at room temperature and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the pyrene and the long carbon chain. The compound can participate in various chemical reactions, including esterification and amidation, and is often used as a building block in the synthesis of functionalized materials or as a probe in fluorescence studies. Its CAS number, 64701-47-9, is a unique identifier that facilitates its recognition in chemical databases and literature.
Formula:C26H28O2
InChI:InChI=1/C26H28O2/c27-24(28)12-7-5-3-1-2-4-6-9-19-13-14-22-16-15-20-10-8-11-21-17-18-23(19)26(22)25(20)21/h8,10-11,13-18H,1-7,9,12H2,(H,27,28)
SMILES:C(CCCCc1ccc2ccc3cccc4ccc1c2c34)CCCCC(=O)O
Synonyms:- 10-(Pyren-1-Yl)Decanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Pyrenedecanoic Acid
CAS:Controlled ProductFormula:C26H28O2Color and Shape:NeatMolecular weight:372.4991-Pyrenedecanoic acid
CAS:<p>1-Pyrenedecanoic acid is a lipid that is found in the mitochondria of rat liver cells. It has been shown to inhibit mitochondrial membrane potential, which affects the production of ATP and reactive oxygen species. 1-Pyrenedecanoic acid also inhibits enzyme activity in rat liver microsomes, which may be due to its ability to form an acid and cause a conformational change in the enzymes. This lipid has also been shown to affect calcium signaling in cardiac and liver cells as well as cell proliferation in tissue culture models. The optimum pH for 1-pyrenedecanoic acid is 7.0 and it has a molecular weight of 292.14 g/mol.</p>Formula:C26H28O2Purity:Min. 95%Color and Shape:PowderMolecular weight:372.5 g/mol

