CymitQuimica logo

CAS 64703-88-4

:

β-D-Glucopyranoside, [(1S,4aS,6S,7R,7aS)-1,4a,5,6,7,7a-hexahydro-6-hydroxy-7-(hydroxymethyl)-1-(3-methyl-1-oxobutoxy)cyclopenta[c]pyran-4-yl]methyl 6-O-β-D-glucopyranosyl-

Description:
The chemical substance known as β-D-Glucopyranoside, with the CAS number 64703-88-4, is a glycoside that features a glucopyranosyl moiety linked to a cyclopentapyran derivative. This compound is characterized by its complex structure, which includes multiple hydroxyl groups, contributing to its solubility in water and potential for hydrogen bonding. The presence of the glucopyranosyl group suggests that it may exhibit sweetening properties and could be involved in various biological activities, such as acting as a substrate for glycosylation reactions. Its stereochemistry, indicated by the specific configuration at various chiral centers, plays a crucial role in determining its reactivity and interactions with biological macromolecules. Additionally, the compound may possess antioxidant properties due to the presence of hydroxyl groups, making it of interest in food and pharmaceutical applications. Overall, β-D-Glucopyranoside is a versatile compound with potential uses in various fields, including biochemistry and medicinal chemistry.
Formula:C27H44O16
InChI:InChI=1S/C27H44O16/c1-10(2)3-17(31)43-25-18-12(4-14(30)13(18)5-28)11(7-38-25)8-39-26-24(37)22(35)20(33)16(42-26)9-40-27-23(36)21(34)19(32)15(6-29)41-27/h7,10,12-16,18-30,32-37H,3-6,8-9H2,1-2H3/t12-,13-,14+,15-,16-,18+,19-,20-,21+,22+,23-,24-,25+,26-,27-/m1/s1
InChI key:InChIKey=AKTRFOPOAKDICT-GHHIWPQQSA-N
SMILES:O(C(CC(C)C)=O)[C@H]1[C@]2([C@@](C(CO[C@@H]3O[C@H](CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)=CO1)(C[C@H](O)[C@H]2CO)[H])[H]
Synonyms:
  • β-D-Glucopyranoside, [(1S,4aS,6S,7R,7aS)-1,4a,5,6,7,7a-hexahydro-6-hydroxy-7-(hydroxymethyl)-1-(3-methyl-1-oxobutoxy)cyclopenta[c]pyran-4-yl]methyl 6-O-β-D-glucopyranosyl-
  • Kanokoside D
  • β-D-Glucopyranoside, [1,4a,5,6,7,7a-hexahydro-6-hydroxy-7-(hydroxymethyl)-1-(3-methyl-1-oxobutoxy)cyclopenta[c]pyran-4-yl]methyl 6-O-β-D-glucopyranosyl-, [1S-(1α,4aα,6α,7β,7aα)]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Kanokoside D

    CAS:
    <p>Kanokoside D is a useful organic compound for research related to life sciences. The catalog number is T124484 and the CAS number is 64703-88-4.</p>
    Formula:C27H44O16
    Color and Shape:Solid
    Molecular weight:624.633