CAS 64715-85-1

(R)-(-)-1-Amino-1-phenyl-2-methoxyethane

Description:

(R)-(-)-1-Amino-1-phenyl-2-methoxyethane, with the CAS number 64715-85-1, is an organic compound characterized by its chiral amine structure. It features a phenyl group attached to a central carbon atom, which is also bonded to an amino group and a methoxy group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits basic properties due to the presence of the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group contributes to its solubility in organic solvents and may influence its reactivity and interaction with other molecules. As a chiral compound, it can exist in two enantiomeric forms, with the (R)-(-) configuration being one of them, which may impart specific biological activities or pharmacological effects. Its applications can range from use in pharmaceuticals to serving as a building block in organic synthesis.

Formula: C₉H₁₃NO

InChI: InChI=1/C9H13NO/c1-11-7-9(10)8-5-3-2-4-6-8/h2-6,9H,7,10H2,1H3/t9-/m0/s1

SMILES: COC[C@@H](c1ccccc1)N

Synonyms:

• (1R)-2-methoxy-1-phenyl-ethanamine

(R)-(-)-1-Amino-1-phenyl-2-methoxyethane

CAS: 64715-85-1

Formula: C₉H₁₃NO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 151.2056

Ref: IN-DA00EFLC

(R)-(-)-1-Amino-1-phenyl-2-methoxyethane

CAS: 64715-85-1

(R)-(-)-1-Amino-1-phenyl-2-methoxyethane

Formula: C₉H₁₃NO

Purity: 95%

Color and Shape: yellow liquid

Molecular weight: 151.21g/mol

Ref: 54-OR316004

(R)-2-Methoxy-1-phenylethanamine

CAS: 64715-85-1

Formula: C₉H₁₃NO

Purity: 95%

Color and Shape: Liquid, Oil

Molecular weight: 151.209

Ref: 10-F445844