CymitQuimica logo

CAS 64724-10-3

:

1-(2-chloroethyl)tetrahydro-1H,5H-[1,3,2]diazaphospholo[2,1-b][1,3,2]oxazaphosphinine 9-oxide

Description:
1-(2-chloroethyl)tetrahydro-1H,5H-[1,3,2]diazaphospholo[2,1-b][1,3,2]oxazaphosphinine 9-oxide, with CAS number 64724-10-3, is a complex organophosphorus compound characterized by its unique structural features, including a diazaphospholo framework and an oxazaphosphinine moiety. This compound typically exhibits properties associated with organophosphorus compounds, such as potential biological activity and reactivity due to the presence of the chloroethyl group, which can facilitate nucleophilic substitution reactions. The presence of the phosphorus atom in its structure suggests potential applications in various fields, including agriculture as a pesticide or herbicide, and in materials science for the development of flame retardants. Additionally, the compound may exhibit specific solubility characteristics, stability under certain conditions, and potential toxicity, which are important for its handling and application. Its synthesis and reactivity can be influenced by the presence of functional groups and the overall molecular geometry, making it a subject of interest in both synthetic and applied chemistry.
Formula:C7H14ClN2O2P
InChI:InChI=1/C7H14ClN2O2P/c8-2-4-10-6-5-9-3-1-7-12-13(9,10)11/h1-7H2
SMILES:C1CN2CCN(CCCl)P2(=O)OC1
Synonyms:
  • 1H,5H-[1,3,2]Diazaphospholo[2,1-b][1,3,2]oxazaphosphorine, 1-(2-chloroethyl)-2,3,6,7-tetrahydro-, 9-oxide
  • 1-(2-Chloroethyl)tetrahydro-1H,5H-[1,3,2]diazaphospholo[2,1-b][1,3,2]oxazaphosphinine 9-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.