CAS 64748-79-4
:Azumolene
Description:
Azumolene, identified by the CAS number 64748-79-4, is a chemical substance that falls within the category of hydrocarbon compounds, specifically a type of polycyclic aromatic hydrocarbon (PAH). It is typically derived from petroleum sources and is characterized by its complex structure, which includes multiple fused aromatic rings. Azumolene is known for its hydrophobic nature, making it insoluble in water but soluble in organic solvents. This compound exhibits properties such as high thermal stability and resistance to degradation, which can make it useful in various industrial applications, including as a component in lubricants, coatings, and sealants. Additionally, due to its aromatic structure, Azumolene may also possess certain biological activities, although its environmental and health impacts require careful consideration. As with many PAHs, there are concerns regarding its potential toxicity and carcinogenicity, necessitating appropriate handling and regulatory measures in its use and disposal.
Formula:C13H9BrN4O3
InChI:InChI=1/C13H9BrN4O3/c14-9-3-1-8(2-4-9)10-5-15-12(21-10)6-16-18-7-11(19)17-13(18)20/h1-6H,7H2,(H,17,19,20)
SMILES:c1cc(ccc1c1cnc(C=NN2CC(=NC2=O)O)o1)Br
Synonyms:- Azumolene [INN]
- Azumoleno
- Azumoleno [Spanish]
- Azumolenum
- Azumolenum [Latin]
- Unii-5U7Io9Cv80
- 2,4-Imidazolidinedione, 1-(((5-(4-bromophenyl)-2-oxazolyl)methylene)amino)-
- 1-({[5-(4-Bromophenyl)-1,3-Oxazol-2-Yl]Methylidene}Amino)Imidazolidine-2,4-Dione
- Azumolene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Azumolene
CAS:Azumolene (EU4093 free base)Formula:C13H9BrN4O3Purity:98.1% - 98.35%Color and Shape:SolidMolecular weight:349.14Ref: TM-T8815
2mg49.00€5mg73.00€10mg116.00€25mg235.00€50mg373.00€100mg562.00€500mg1,216.00€1mL*10mM (DMSO)82.00€Azumolene
CAS:<p>Azumolene is a muscle relaxant drug, which is a synthetic derivative of dantrolene originating from hydantoin. The mode of action of Azumolene involves the inhibition of calcium ion release from the sarcoplasmic reticulum of skeletal muscle fibers. By impeding this release, Azumolene effectively reduces muscle contraction, thereby acting as a potent muscle relaxant.</p>Formula:C13H9BrN4O3Purity:Min. 95%Color and Shape:PowderMolecular weight:349.14 g/molAzumolene - Bio-X ™
CAS:<p>Azumolene is a Dantrolene analog that is a muscle relaxant. It binds to the ryanodine receptor and inhibits the release of calcium from the sarcoplasmic reticulum. This drug can be used for the research of malignant hyperthermia.</p>Formula:C13H9BrN4O3Purity:Min. 95%Color and Shape:PowderMolecular weight:349.14 g/mol


