
CAS 6475-05-4
:2H-2,7a-Methanoindolo[2,3-a]quinolizine-13-carboxylic acid, 3-ethylidene-1,3,4,6,7,12b-hexahydro-, methyl ester, (2R,3E,5S,7aR,12bS,13R)-
Description:
2H-2,7a-Methanoindolo[2,3-a]quinolizine-13-carboxylic acid, 3-ethylidene-1,3,4,6,7,12b-hexahydro-, methyl ester, with CAS number 6475-05-4, is a complex organic compound characterized by its unique bicyclic structure that incorporates both indole and quinolizine moieties. This compound features multiple stereocenters, which contribute to its chiral nature, influencing its biological activity and interactions. The presence of a carboxylic acid functional group and an ester linkage suggests potential for reactivity and solubility in various solvents. Its structural complexity may confer interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis may involve multi-step organic reactions, highlighting its significance in synthetic organic chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, which is crucial for applications in drug development and material science.
Formula:C20H22N2O2
InChI:InChI=1S/C20H22N2O2/c1-3-12-11-22-9-8-20-14-6-4-5-7-15(14)21-18(20)16(22)10-13(12)17(20)19(23)24-2/h3-7,13,16-17H,8-11H2,1-2H3/b12-3-/t13-,16-,17-,20-/m0/s1
InChI key:InChIKey=LITYYRLWHAQJQS-HTPSJYFDSA-N
SMILES:C(OC)(=O)[C@H]1[C@]23C([C@]4([N@@](CC2)C\C(=C\C)\[C@@]1(C4)[H])[H])=NC=5C3=CC=CC5
Synonyms:- 2H-2,7a-Methanoindolo[2,3-a]quinolizine-13-carboxylic acid, 3-ethylidene-1,3,4,6,7,12b-hexahydro-, methyl ester, [2R-(2α,3E,7aα,12bβ,13S*)]-
- Vincamidine
- 2H-2,7a-Methanoindolo[2,3-a]quinolizine-13-carboxylic acid, 3-ethylidene-1,3,4,6,7,12b-hexahydro-, methyl ester, (2R,3E,5S,7aR,12bS,13R)-
- (+)-Strictamine
- Strictamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Strictamine
CAS:Strictamine is a akuammiline alkaloid.Formula:C20H22N2O2Color and Shape:SolidMolecular weight:322.41
