CAS 64763-82-2
:4,10,16,22-tetramethyl-3,9,15,21-tetrakis(2-methylpropyl)-6,12,18,24-tetra(propan-2-yl)-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosane-2,5,8,11,14,17,20,23-octone
Description:
The chemical substance known as "4,10,16,22-tetramethyl-3,9,15,21-tetrakis(2-methylpropyl)-6,12,18,24-tetra(propan-2-yl)-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosane-2,5,8,11,14,17,20,23-octone" with CAS number 64763-82-2 is a complex organic compound characterized by its intricate structure, which includes multiple functional groups and a large number of carbon atoms. This compound features a tetracyclic framework with several substituents, including methyl and isopropyl groups, which contribute to its steric bulk and influence its physical properties. The presence of oxygen and nitrogen atoms in the form of tetraoxa and tetraaza groups suggests potential for hydrogen bonding and coordination chemistry. Such compounds may exhibit unique solubility characteristics, stability, and reactivity, making them of interest in various fields, including materials science and medicinal chemistry. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C48H84N4O12
InChI:InChI=1/C48H84N4O12/c1-25(2)21-33-45(57)61-38(30(11)12)42(54)50(18)35(23-27(5)6)47(59)63-40(32(15)16)44(56)52(20)36(24-28(7)8)48(60)64-39(31(13)14)43(55)51(19)34(22-26(3)4)46(58)62-37(29(9)10)41(53)49(33)17/h25-40H,21-24H2,1-20H3
SMILES:CC(C)CC1C(=O)OC(C(C)C)C(=O)N(C)C(CC(C)C)C(=O)OC(C(C)C)C(=O)N(C)C(CC(C)C)C(=O)OC(C(C)C)C(=O)N(C)C(CC(C)C)C(=O)OC(C(C)C)C(=O)N1C
Synonyms:- Bassianolide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Bassianolide
CAS:Bassianolide, a cyclodepsipeptide insecticide produced by the fungal species B. bassiana and V. lecanii, demonstrates significant biological activity. Upon oral administration, it induces atony in B. mori silkworms at a concentration of 4 ppm and becomes lethal when concentrations exceed 8 ppm. Remarkably, atony in silkworm larvae can also be triggered by doses as low as 2 µg/larva. Further studies reveal that bassianolide (0.01-1 µM) specifically targets muscarinic receptors to inhibit contractions in isolated guinea pig smooth muscle tissue, elicited by acetylcholine, without affecting nicotinic receptor-induced contractions.Formula:C48H84N4O12Color and Shape:SolidMolecular weight:909.216



