CAS 64779-10-8

4-(4-octylphenyl)-4-oxobutanoic acid

Description:

4-(4-Octylphenyl)-4-oxobutanoic acid, with the CAS number 64779-10-8, is an organic compound characterized by its unique structure that includes a butanoic acid moiety and a long-chain octylphenyl group. This compound typically exhibits properties such as being a solid at room temperature, with a relatively high melting point due to the presence of the hydrophobic octyl chain, which enhances its lipophilicity. The presence of the carbonyl group (ketone) and the carboxylic acid functional group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and amidation. It may also exhibit amphiphilic characteristics, making it useful in applications such as surfactants or additives in polymer formulations. Additionally, its molecular structure suggests potential applications in materials science, particularly in the development of liquid crystals or as a precursor in organic synthesis. Overall, the compound's properties are influenced by its molecular architecture, which combines hydrophobic and polar functionalities.

Formula: C₁₈H₂₆O₃

InChI: InChI=1/C18H26O3/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17(19)13-14-18(20)21/h9-12H,2-8,13-14H2,1H3,(H,20,21)

SMILES: CCCCCCCCc1ccc(cc1)C(=O)CCC(=O)O

4-(4-octylphenyl)-4-oxobutanoic acid

CAS: 64779-10-8

4-(4-octylphenyl)-4-oxobutanoic acid

Purity: ≥95%

Molecular weight: 290.40g/mol

Ref: 54-OR21909