CAS 64779-14-2

4-[4-(hexyloxy)phenyl]-4-oxobutanoic acid

Description:

4-[4-(Hexyloxy)phenyl]-4-oxobutanoic acid, with the CAS number 64779-14-2, is an organic compound characterized by its unique molecular structure that includes a butanoic acid moiety and a phenyl group substituted with a hexyloxy chain. This compound typically exhibits properties associated with both hydrophobic and hydrophilic characteristics due to the presence of the long hexyloxy chain and the carboxylic acid functional group. It is likely to be a solid at room temperature, with potential applications in materials science, particularly in the development of liquid crystals or as an intermediate in organic synthesis. The presence of the hexyloxy group may enhance solubility in organic solvents, while the carboxylic acid group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, this compound may exhibit interesting thermal and optical properties, making it suitable for various applications in chemical and material research.

Formula: C₁₆H₂₂O₄

InChI: InChI=1/C16H22O4/c1-2-3-4-5-12-20-14-8-6-13(7-9-14)15(17)10-11-16(18)19/h6-9H,2-5,10-12H2,1H3,(H,18,19)

SMILES: CCCCCCOc1ccc(cc1)C(=O)CCC(=O)O

4-(4-hexyloxyphenyl)-4-oxobutyric acid

CAS: 64779-14-2

Formula: C₁₆H₂₂O₄

Purity: 97.0%

Molecular weight: 278.348

Ref: 10-F207402