CymitQuimica logo

CAS 6478-79-1

:

2-Methyl-5,6-dichlorobenzimidazole

Description:
2-Methyl-5,6-dichlorobenzimidazole is a chemical compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. This compound features two chlorine atoms at the 5 and 6 positions and a methyl group at the 2 position of the benzene ring. It is typically a solid at room temperature and may exhibit a crystalline structure. The presence of chlorine substituents contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound may also display specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its molecular structure suggests potential biological activity, making it of interest for research in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks. Overall, 2-Methyl-5,6-dichlorobenzimidazole is a notable compound within the benzimidazole class, with diverse implications in chemical research and application.
Formula:C8H6Cl2N2
InChI:InChI=1/C8H6Cl2N2/c1-4-11-7-2-5(9)6(10)3-8(7)12-4/h2-3H,1H3,(H,11,12)
InChI key:WMOBNOCVMZFPEN-UHFFFAOYSA-N
SMILES:Cc1nc2cc(c(cc2[nH]1)Cl)Cl
Synonyms:
  • 5,6-dichloro-2-methyl-1H-benzimidazole
  • 5,6-Dichloro-2-methylbenzimidazole
Found 5 products.