CymitQuimica logo

CAS 64781-79-9

:

4-Methyl-1H-pyrazol-3-amine

Description:
4-Methyl-1H-pyrazol-3-amine, with the CAS number 64781-79-9, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group at the 4-position and an amino group at the 3-position of the pyrazole ring, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific conditions. The presence of the amino group allows for hydrogen bonding, which can influence its interactions with other molecules. 4-Methyl-1H-pyrazol-3-amine is of interest in medicinal chemistry and agricultural chemistry, where it may serve as a building block for the synthesis of more complex compounds or as a potential active ingredient in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C4H7N3
InChI:InChI=1/C4H7N3/c1-3-2-6-7-4(3)5/h2H,1H3,(H3,5,6,7)
InChI key:KIHDRFDQWVMKES-UHFFFAOYSA-N
SMILES:Cc1c[nH][nH]c1=N
Synonyms:
  • 1H-pyrazol-3-amine, 4-methyl-
Found 4 products.