CAS 6479-17-0
:N-methylquinoxalin-2-amine
Description:
N-methylquinoxalin-2-amine is an organic compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. This compound features a methyl group attached to the nitrogen atom at the first position and an amino group at the second position of the quinoxaline ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. N-methylquinoxalin-2-amine is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial or antitumor properties. The compound's reactivity can be influenced by the electron-donating nature of the methyl group and the electron-withdrawing characteristics of the quinoxaline ring, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c1-10-9-6-11-7-4-2-3-5-8(7)12-9/h2-6H,1H3,(H,10,12)
SMILES:CNc1cnc2ccccc2n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-Methylquinoxalin-2-amine
CAS:N-Methylquinoxalin-2-amine is a tertiary amine that belongs to the class of quinoxaline derivatives. It has been shown to be an effective inhibitor of bacterial growth. This drug can be used as a potential antibiotic against bacteria such as Staphylococcus aureus, Escherichia coli, and Klebsiella pneumoniae. N-Methylquinoxalin-2-amine appears to inhibit the synthesis of DNA by preventing transcription and replication. The equilibrium between the two tautomers is dependent on pH, which may result in different solubility properties in various solutions. The UV spectrum of this compound shows absorption peaks at 220 nm (mu), 244 nm (nu), and 302 nm (xi). The UV spectrum also shows absorption peaks at 254 nm (sigma) and 295 nm (phi). N-Methylquinoxalin-2-amine also tautomerizes from the keto form to the enFormula:C9H9N3Purity:Min. 95%Molecular weight:159.19 g/mol
