CymitQuimica logo

CAS 64801-56-5

:

N~2~-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-L-glutamine

Description:
N~2~-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-L-glutamine, with the CAS number 64801-56-5, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a complex structure that includes a glutamine moiety linked to a benzoyl group, which is further substituted with a pteridine derivative. The presence of the 2,4-diaminopteridin-6-yl group suggests potential biological activity, particularly in relation to folate metabolism or as an antitumor agent, given the role of pteridines in cellular processes. The compound is likely to exhibit solubility in polar solvents due to its amino acid and polar functional groups. Its molecular structure may confer specific interactions with biological targets, making it of interest in medicinal chemistry. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic potential would be necessary to fully understand its characteristics and applications in a biological context.
Formula:C20H23N9O4
InChI:InChI=1/C20H23N9O4/c1-29(9-11-8-24-17-15(25-11)16(22)27-20(23)28-17)12-4-2-10(3-5-12)18(31)26-13(19(32)33)6-7-14(21)30/h2-5,8,13H,6-7,9H2,1H3,(H2,21,30)(H,26,31)(H,32,33)(H4,22,23,24,27,28)/t13-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.