CAS 64816-14-4
:D-valyl-L-leucyl-N~5~-(diaminomethylidene)-N-(4-nitrophenyl)-L-ornithinamide
Description:
D-valyl-L-leucyl-N~5~-(diaminomethylidene)-N-(4-nitrophenyl)-L-ornithinamide, with the CAS number 64816-14-4, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a complex structure comprising multiple functional groups, including amino groups, which contribute to its potential biological activity. The presence of the nitrophenyl moiety suggests that it may exhibit unique electronic properties, possibly influencing its reactivity and interactions with biological targets. The compound is likely to be soluble in polar solvents due to its amino acid components, while its specific solubility characteristics would depend on the overall structure and substituents. As a peptide-like molecule, it may participate in various biochemical processes, potentially serving as a substrate or inhibitor in enzymatic reactions. Its application could extend to fields such as medicinal chemistry, where it may be explored for therapeutic uses or as a research tool in studying protein interactions. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C23H38N8O5
InChI:InChI=1/C23H38N8O5/c1-13(2)12-18(30-22(34)19(24)14(3)4)21(33)29-17(6-5-11-27-23(25)26)20(32)28-15-7-9-16(10-8-15)31(35)36/h7-10,13-14,17-19H,5-6,11-12,24H2,1-4H3,(H,28,32)(H,29,33)(H,30,34)(H4,25,26,27)/t17-,18-,19+/m0/s1
Synonyms:- Val-Leu-Arg-P-Nitroanilide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-D-Val-Leu-Arg-pNA · 2 AcOH
CAS:D-VLR-pNA, chromogenic substrate for a convenient, sensitive, and selective assay of glandular kallikrein activity, e.g. of human and rat urinary kallikreins. Stock solutions of this substrate are best prepared in DMSO.Formula:C23H38N8O5·2C2H4O2Purity:> 98%Color and Shape:Light Yellow PowderMolecular weight:626.71Val-Leu-Arg-p-nitroanilide
CAS:Formula:C23H38N8O5Purity:95%Color and Shape:SolidMolecular weight:506.5984H-D-Val-Leu-Arg-pNA·2 AcOH
CAS:H-D-Val-Leu-Arg-pNA·2 AcOH is a kallikrein inhibitor that can be used as a blood pressure lowering agent. It inhibits the enzymatic activity of kallikrein, which is responsible for the conversion of kininogen to bradykinin, and thus prevents the production of natriuretic peptides. H-D-Val-Leu-Arg-pNA·2 AcOH has been shown to decrease blood pressure in animals by inhibiting filtration through the glomerulus and by blocking renin release from juxtaglomerular cells.
Formula:C23H38N8O5·2C2H4O2Purity:Min. 95%Molecular weight:626.7 g/mol


