CymitQuimica logo

CAS 64821-69-8

:

tritylium trifluoromethanesulfonate

Description:
Tritylium trifluoromethanesulfonate, with the CAS number 64821-69-8, is a chemical compound characterized by its tritylium cation, which is a stable, positively charged species derived from triphenylmethane. This compound is typically used in organic synthesis as a powerful electrophile due to the stability of the tritylium ion, making it effective in various reactions, including alkylation and acylation processes. The trifluoromethanesulfonate (triflate) anion is known for its excellent leaving group ability, enhancing the reactivity of the tritylium cation in nucleophilic substitution reactions. Tritylium trifluoromethanesulfonate is often utilized in the preparation of complex organic molecules, particularly in the field of medicinal chemistry and materials science. Its properties include high solubility in polar organic solvents and stability under standard laboratory conditions, although it should be handled with care due to its reactivity. Overall, this compound serves as a valuable tool in synthetic organic chemistry, facilitating the formation of various carbon-carbon and carbon-heteroatom bonds.
Formula:C20H16F3O3S
InChI:InChI=1/C19H15.CHF3O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7/h1-15H;(H,5,6,7)/q+1;/p-1
Synonyms:
  • Triphenylmethylium Trifluoromethanesulfonate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.