CAS 64835-48-9

N-(4-Bromo-3,5-dimethylphenyl)acetamide

Description:

N-(4-Bromo-3,5-dimethylphenyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid and an aromatic amine. The presence of the bromine atom and two methyl groups on the phenyl ring contributes to its unique chemical properties, including its reactivity and potential biological activity. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic structure. The bromine substituent can enhance the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the methyl groups can influence the steric hindrance around the amide bond, potentially affecting its interactions with biological targets. N-(4-Bromo-3,5-dimethylphenyl)acetamide may be of interest in medicinal chemistry for its potential pharmacological properties, although specific biological activities would require further investigation. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₀H₁₂BrNO

InChI: InChI=1S/C10H12BrNO/c1-6-4-9(12-8(3)13)5-7(2)10(6)11/h4-5H,1-3H3,(H,12,13)

InChI key: InChIKey=HXXWQYBIQBWFDI-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=CC(C)=C(Br)C(C)=C1

Synonyms:

• 4-Bromo-3,5-dimethylacetanilide
• acetamide, N-(4-bromo-3,5-dimethylphenyl)-
• N-(4-Bromo-3,5-dimethylphenyl)acetamide
• N-(4-Bromo-3,5-dimethylphenyl)acetamide

N-Acetyl 4-bromo-3,5-dimethylaniline

CAS: 64835-48-9

Formula: C₁₀H₁₂BrNO

Purity: 95%

Molecular weight: 242.1124

Ref: IN-DA00EBOD

N-(4-Bromo-3,5-dimethylphenyl)acetamide

CAS: 64835-48-9

Formula: C₁₀H₁₂BrNO

Purity: ≥95%

Color and Shape: Liquid, No data available.

Molecular weight: 242.116

Ref: 10-F211772