CAS 6484-25-9
:4-Chloro-2-phenylquinazoline
Description:
4-Chloro-2-phenylquinazoline is an organic compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the 4-position and a phenyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer effects, although specific biological activities can vary based on structural modifications and the presence of substituents. The compound is generally soluble in organic solvents but may have limited solubility in water. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Chloro-2-phenylquinazoline serves as an important building block in synthetic organic chemistry and drug discovery.
Formula:C14H9ClN2
InChI:InChI=1S/C14H9ClN2/c15-13-11-8-4-5-9-12(11)16-14(17-13)10-6-2-1-3-7-10/h1-9H
InChI key:InChIKey=OBHKONRNYCDRKM-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(N1)C3=CC=CC=C3)C=CC=C2
Synonyms:- 2-Phenyl-4-chloroquinazoline
- AM-ex-OL
- NSC 400965
- Quinazoline, 4-chloro-2-phenyl-
- 4-Chloro-2-phenylquinazoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-CHLORO-2-PHENYLQUINAZOLINE
CAS:Formula:C14H9ClN2Purity:97%Color and Shape:SolidMolecular weight:240.68774-chloro-2-phenylquinazoline
CAS:4-chloro-2-phenylquinazolinePurity:97%Molecular weight:240.68766g/mol4-Chloro-2-phenylquinazoline
CAS:Formula:C14H9ClN2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:240.694-Chloro-2-phenylquinazoline
CAS:Purity:95.0%Color and Shape:Solid, White solidMolecular weight:240.690002441406254-Chloro-2-phenylquinazoline
CAS:4-Chloro-2-phenylquinazoline is a ligand that inhibits the growth of bacteria by binding to their DNA. It has a molecular weight of 242.6 g/mol, and can be synthesized in two steps from 2-phenylaniline and o-chloroacetophenone. The pharmacokinetic properties of this compound have been studied using magnetic nanoparticles. 4-Chloro-2-phenylquinazoline has been shown to inhibit cancer cells and also has anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis. This ligand binds to the nitrogen nucleophiles on the bacterial cell wall (e.g., trichophyton mentagrophytes) and prevents them from reacting with chlorine atoms in the environment, thus inhibiting bacterial growth.Formula:C14H9ClN2Purity:Min. 95%Color and Shape:White PowderMolecular weight:240.69 g/mol




