CAS 6484-28-2

2-methylquinazoline-4-thiolate

Description:

2-Methylquinazoline-4-thiolate is a heterocyclic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring system. The presence of a methyl group at the second position and a thiol group at the fourth position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic nature. The thiolate group can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, making it of interest in coordination chemistry and materials science. Additionally, compounds of this class may exhibit biological activity, potentially serving as precursors or intermediates in the synthesis of pharmaceuticals or agrochemicals. The stability of 2-methylquinazoline-4-thiolate can be influenced by environmental factors such as pH and temperature, and it may undergo oxidation or other transformations under certain conditions. Overall, its structural features and reactivity make it a compound of interest in both synthetic and applied chemistry.

Formula: C₉H₇N₂S

InChI: InChI=1/C9H8N2S/c1-6-10-8-5-3-2-4-7(8)9(12)11-6/h2-5H,1H3,(H,10,11,12)/p-1

SMILES: Cc1nc2ccccc2c(n1)[S-]

2-Methylquinazoline-4-thiol

CAS: 6484-28-2

2-Methylquinazoline-4-thiol is a heterocyclic compound with a thione group. Its amide groups are similar to those found in peptides, which play an important role in the coordination chemistry of the molecule. The 2-methylquinazoline-4-thiol skeleton is tetracyclic and can be used for synthetic purposes. This compound has been shown to have hepatoprotective properties, but also has cytotoxic effects on cells.

Formula: C₉H₈N₂S

Purity: Min. 95%

Molecular weight: 176.24 g/mol

Ref: 3D-GAA48428