CAS 64855-00-1
:Lappaol C
Description:
Lappaol C is a naturally occurring chemical compound classified as a sesquiterpene, primarily derived from the roots of the plant Arctium lappa, commonly known as burdock. This compound is characterized by its complex bicyclic structure, which contributes to its unique biological activities. Lappaol C exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial effects, making it of interest in medicinal chemistry and natural product research. Its potential applications extend to traditional medicine, where it is utilized for its therapeutic benefits. Additionally, Lappaol C may interact with various biological pathways, although further studies are needed to fully elucidate its mechanisms of action and potential health benefits. As with many natural compounds, its safety profile and efficacy in clinical settings require thorough investigation. Overall, Lappaol C represents a fascinating subject for research in both chemistry and pharmacology, highlighting the importance of plant-derived substances in drug discovery and development.
Formula:C30H34O10
InChI:InChI=1S/C30H34O10/c1-37-25-11-16(4-6-23(25)32)9-20-19(15-40-30(20)36)8-17-10-21(29(35)27(12-17)39-3)22(14-31)28(34)18-5-7-24(33)26(13-18)38-2/h4-7,10-13,19-20,22,28,31-35H,8-9,14-15H2,1-3H3/t19-,20+,22?,28?/m0/s1
InChI key:InChIKey=BWOAMGHNXHLWMX-BAOMQRJLSA-N
SMILES:C(C(O)C1=CC(OC)=C(O)C=C1)(CO)C2=CC(C[C@@H]3[C@@H](CC4=CC(OC)=C(O)C=C4)C(=O)OC3)=CC(OC)=C2O
Synonyms:- NSC 287068
- Lappaol C
- 2(3H)-Furanone, dihydro-4-[[4-hydroxy-3-[2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(hydroxymethyl)ethyl]-5-methoxyphenyl]methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]-, (3R,4R)-
- (3R,4R)-Dihydro-4-[[4-hydroxy-3-[2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(hydroxymethyl)ethyl]-5-methoxyphenyl]methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2(3H)-furanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lappaol C
CAS:Lappaol C: antioxidant, antiaging, promotes C. elegans longevity/stress resistance, potential cancer adjuvant.Formula:C30H34O10Purity:98%Color and Shape:SolidMolecular weight:554.59Lappaol C
CAS:Lappaol C is a bioactive compound, which is a lignan derived from the roots of the Arctium lappa plant, commonly known as burdock. This compound is naturally sourced from this traditional medicinal plant, widely recognized in herbal medicine for its therapeutic properties. The mode of action of Lappaol C involves modulation of various biological pathways, including antioxidative and anti-inflammatory mechanisms. It interacts with cellular processes to mitigate oxidative stress and may inhibit the growth of certain cancer cells by interfering with their proliferative signaling pathways.
Formula:C30H34O10Purity:Min. 95%Molecular weight:554.60 g/mol

