CAS 6487-91-8
:2-(3-methylphenyl)ethanethioamide
Description:
2-(3-Methylphenyl)ethanethioamide, also known by its CAS number 6487-91-8, is an organic compound characterized by the presence of a thioamide functional group. This compound features a two-carbon ethyl chain attached to a thioamide group (-C(=S)NHR), where the nitrogen is further substituted with a 3-methylphenyl group. The presence of the methyl group on the aromatic ring contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Typically, thioamides exhibit properties similar to amides but with distinct differences in reactivity due to the sulfur atom, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, 2-(3-methylphenyl)ethanethioamide is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C9H11NS
InChI:InChI=1/C9H11NS/c1-7-3-2-4-8(5-7)6-9(10)11/h2-5H,6H2,1H3,(H2,10,11)
SMILES:Cc1cccc(c1)CC(=N)S
Synonyms:- Benzeneethanethioamide, 3-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
