CAS 64874-38-0

6-bromo-1,8-naphthyridin-2-amine

Description:

6-Bromo-1,8-naphthyridin-2-amine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of a bromine atom at the 6-position and an amino group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals targeting various diseases. The bromine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the nitrogen atoms in the naphthyridine ring can participate in hydrogen bonding, which may affect its pharmacokinetic properties. As with many nitrogen-containing heterocycles, 6-bromo-1,8-naphthyridin-2-amine may also exhibit fluorescence, making it useful in certain analytical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₈H₆BrN₃

InChI: InChI=1/C8H6BrN3/c9-6-3-5-1-2-7(10)12-8(5)11-4-6/h1-4H,(H2,10,11,12)

SMILES: c1cc(=N)[nH]c2c1cc(cn2)Br

Synonyms:

• 1,8-Naphthyridin-2-Amine, 6-Bromo-
• 6-Bromo-1,8-naphthyridin-2-amine
• 2-AMINO-6-BROMO-1,8-NAPHTHYRIDINE
• 6-Bromo-1,8-naphthyridin-2-amine, 2-Amino-6-bromo-1,8-diazanaphthalene

2-Amino-6-bromo-1,8-naphthyridine

CAS: 64874-38-0

Formula: C₈H₆BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 224.0573

Ref: IN-DA00EFUQ

2-Amino-6-bromo-1,8-naphthyridine

CAS: 64874-38-0

2-Amino-6-bromo-1,8-naphthyridine

Purity: 98%

Molecular weight: 224.06g/mol

Ref: 54-OR41142

2-Amino-6-bromo-1,8-naphthyridine

CAS: 64874-38-0

Formula: C₈H₆BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 224.061

Ref: 10-F076058