CAS 64890-70-6

(2S,3S)-2,3-Dihydro-3-hydroxy-6-(hydroxymethyl)-2,5,7-trimethyl-1H-inden-1-one

Description:

(2S,3S)-2,3-Dihydro-3-hydroxy-6-(hydroxymethyl)-2,5,7-trimethyl-1H-inden-1-one, with the CAS number 64890-70-6, is a chemical compound characterized by its complex bicyclic structure, which includes an indene framework. This compound features multiple functional groups, including hydroxyl (-OH) groups and a ketone (C=O) moiety, contributing to its reactivity and potential biological activity. The presence of three methyl groups indicates that it is a substituted derivative, which can influence its solubility and interaction with other molecules. The stereochemistry denoted by (2S,3S) suggests specific spatial arrangements of the atoms, which can be crucial for its biological function and interactions. This compound may exhibit properties such as antioxidant activity or serve as a precursor in synthetic organic chemistry. Its unique structure and functional groups make it of interest in various fields, including medicinal chemistry and materials science. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₃H₁₆O₃

InChI: InChI=1S/C13H16O3/c1-6-4-9-11(7(2)10(6)5-14)13(16)8(3)12(9)15/h4,8,12,14-15H,5H2,1-3H3/t8-,12-/m0/s1

InChI key: InChIKey=XGHDADRUKBUYPP-UFBFGSQYSA-N

SMILES: O[C@@H]1C=2C(=C(C)C(CO)=C(C)C2)C(=O)[C@H]1C

Synonyms:

• (2S,3S)-2,3-Dihydro-3-hydroxy-6-(hydroxymethyl)-2,5,7-trimethyl-1H-inden-1-one
• 1H-Inden-1-one,2,3-dihydro-3-hydroxy-6-(hydroxymethyl)-2,5,7-trimethyl-, (2S-trans)-
• Norpterosin C
• 1H-Inden-1-one, 2,3-dihydro-3-hydroxy-6-(hydroxymethyl)-2,5,7-trimethyl-, (2S,3S)-

trans-Norpterosin C

CAS: 64890-70-6

trans-Norpterosin C is a natural product from Pteris semipinnata.

Formula: C₁₃H₁₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 220.26

Ref: TM-TN5168

trans-Norpterosin C

CAS: 64890-70-6

Formula: C₁₃H₁₆O₃

Purity: 95%~99%

Molecular weight: 220.268

Ref: BP-SBP03621

3-Hydroxy-6-(hydroxymethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one

CAS: 64890-70-6

3-Hydroxy-6-(hydroxymethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one is a naturally occurring phytochemical, which is derived from various plant sources known for their medicinal properties. The compound functions as a potent antioxidant, neutralizing free radicals and reducing oxidative stress at a cellular level. This antioxidative mechanism involves the donation of hydrogen atoms to stabilize reactive oxygen species, thereby protecting cellular components from damage.

Formula: C₁₃H₁₆O₃

Purity: Min. 95%

Molecular weight: 220.26 g/mol

Ref: 3D-PCA89070