CAS 6490-42-2

1-ethylpyrimidine-2,4(1H,3H)-dione

Description:

1-Ethylpyrimidine-2,4(1H,3H)-dione, with the CAS number 6490-42-2, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with an ethyl group and two carbonyl groups at the 2 and 4 positions. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, particularly as a building block in the synthesis of biologically active molecules. The presence of the ethyl group enhances its lipophilicity, which can influence its biological activity and interaction with various biological targets. Additionally, the diketone functionality may participate in various chemical reactions, such as condensation and nucleophilic addition, making it a versatile intermediate in organic synthesis. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity, and appropriate safety measures should be observed in laboratory settings.

Formula: C₆H₈N₂O₂

InChI: InChI=1/C6H8N2O2/c1-2-8-4-3-5(9)7-6(8)10/h3-4H,2H2,1H3,(H,7,9,10)

SMILES: CCn1ccc(nc1=O)O

1-Ethylpyrimidine-2,4(1H,3H)-dione

CAS: 6490-42-2

Formula: C₆H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 140.1399

Ref: IN-DA00ETHY

1-Ethyluracil

CAS: 6490-42-2

1-Ethyluracil

Purity: ≥95%

Molecular weight: 140.14g/mol

Ref: 54-OR43594

1-Ethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione

CAS: 6490-42-2

Purity: 98%

Molecular weight: 140.1419983

Ref: 10-F657519

1-Ethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione

CAS: 6490-42-2

1-Ethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione (ETP) is a potent inhibitor of pyrimidine biosynthesis. It has been shown to inhibit the growth of cancer cells in vitro and in vivo. ETP binds to the enzyme dihydroorotate dehydrogenase and prevents the formation of orotic acid from l-tartaric acid. This inhibition leads to an accumulation of orotic acid and l-tartaric acid in the cell which inhibits cellular respiration. ETP also inhibits other enzymes involved in DNA replication, such as ribonucleotide reductase and thymidylate synthase. This inhibition leads to decreased synthesis of DNA and RNA molecules that are necessary for cell division. ETP has also been shown to be effective against hepatitis B virus by inhibiting viral DNA synthesis and causing viral DNA degradation.

Formula: C₆H₈N₂O₂

Purity: Min. 95%

Molecular weight: 140.14 g/mol

Ref: 3D-GAA49042