CAS 64910-68-5

4-aminophenyl 3-amino-4-chlorobenzenesulfonate

Description:

4-Aminophenyl 3-amino-4-chlorobenzenesulfonate, with the CAS number 64910-68-5, is an organic compound characterized by the presence of both amino and sulfonate functional groups. This compound features a sulfonate group (-SO3H) attached to a chlorinated aromatic ring, which enhances its solubility in water and contributes to its reactivity. The amino groups (-NH2) present in the structure can participate in various chemical reactions, making it useful in synthetic organic chemistry and potentially in dye manufacturing or as an intermediate in pharmaceuticals. The chlorobenzene moiety introduces additional electronic effects, influencing the compound's reactivity and interaction with other substances. Its properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other chemical species. Overall, 4-aminophenyl 3-amino-4-chlorobenzenesulfonate is a versatile compound with applications in various fields, including materials science and medicinal chemistry.

Formula: C₁₂H₁₁ClN₂O₃S

InChI: InChI=1/C12H11ClN2O3S/c13-11-6-5-10(7-12(11)15)19(16,17)18-9-3-1-8(14)2-4-9/h1-7H,14-15H2

SMILES: c1cc(ccc1N)OS(=O)(=O)c1ccc(c(c1)N)Cl

Synonyms:

• 3-Amino-4-chloro-benzenesulfonic acid 4-amino-phenyl ester

3-Amino-4-chloro-benzenesulfonic acid 4-amino-phenyl ester

CAS: 64910-68-5

Versatile small molecule scaffold

Formula: C₁₂H₁₁ClN₂O₃S

Purity: Min. 95%

Molecular weight: 298.75 g/mol

Ref: 3D-PCA91068