CAS 64911-18-8

1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]tetrahydrofuran-2-yl]pyrimidine-2,4-dione

Description:

The chemical substance known as 1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]tetrahydrofuran-2-yl]pyrimidine-2,4-dione, with the CAS number 64911-18-8, is a complex organic compound characterized by its unique structural features. It contains a pyrimidine ring, which is a six-membered aromatic heterocycle with nitrogen atoms, and is substituted with various functional groups, including silyl ethers and a tetrahydrofuran moiety. The presence of tert-butyl and dimethylsilyl groups suggests that the compound may exhibit hydrophobic properties, enhancing its solubility in organic solvents. Additionally, the stereochemistry indicated by the (2R,5R) configuration implies specific spatial arrangements that could influence its reactivity and interactions with biological systems. This compound may have applications in medicinal chemistry or materials science, particularly in the development of pharmaceuticals or as a building block in organic synthesis. Its stability, reactivity, and potential biological activity would depend on the specific conditions under which it is used.

Formula: C₂₁H₄₀N₂O₅Si₂

InChI: InChI=1/C21H40N2O5Si2/c1-20(2,3)29(7,8)26-14-16-15(28-30(9,10)21(4,5)6)13-18(27-16)23-12-11-17(24)22-19(23)25/h11-12,15-16,18H,13-14H2,1-10H3,(H,22,24,25)/t15?,16-,18-/m1/s1

SMILES: CC(C)(C)[Si](C)(C)OC[C@@H]1C(C[C@H](n2ccc(nc2=O)O)O1)O[Si](C)(C)C(C)(C)C

3'',5''-Bis-O-(tert-butyldimethylsilyl)-2’-deoxyuridine

CAS: 64911-18-8

Ref: 7W-GN5458

3’,5’-Bis-O-(tert-butyldimethylsilyl)-2’-deoxyuridine

CAS: 64911-18-8

Formula: C₂₁H₄₀N₂O₅Si₂

Molecular weight: 456.73

Ref: 4Z-U-0116

3',5'-Bis-O-(tert-butyldimethylsilyl)-2'-deoxyuridine

CAS: 64911-18-8

3',5'-Bis-O-(tert-butyldimethylsilyl)-2'-deoxyuridine is a synthetic nucleoside that is used in antiviral and anticancer research. It is an activator of the monophosphate form of DNA and RNA, leading to their synthesis. 3',5'-Bis-O-(tert-bulyldimethylsilyl)-2'-deoxyuridine has been shown to have antitumour activity against cancer cells.

Formula: C₂₁H₄₀N₂O₅Si₂

Purity: Min. 95%

Molecular weight: 456.72 g/mol

Ref: 3D-NB18821

3’,5’-Bis-O-(tert-butyldimethylsilyl)-2’-deoxyuridine

CAS: 64911-18-8

Formula: C₂₁H₄₀N₂O₅Si₂

Molecular weight: 456.73

Ref: ST-EA-CP-U6018