CymitQuimica logo

CAS 64922-04-9

:

ethyl 1H-1,2,4-triazole-5-carboxylate

Description:
Ethyl 1H-1,2,4-triazole-5-carboxylate, with the CAS number 64922-04-9, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically appears as a white to off-white solid and is soluble in polar organic solvents. It is known for its role in various chemical reactions, particularly in the synthesis of agrochemicals and pharmaceuticals, due to its ability to act as a building block for more complex molecules. The presence of the carboxylate group enhances its reactivity, making it a useful intermediate in organic synthesis. Additionally, the ethyl ester functionality contributes to its solubility and reactivity profile. Ethyl 1H-1,2,4-triazole-5-carboxylate may exhibit biological activity, which has led to interest in its potential applications in medicinal chemistry. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C5H7N3O2
InChI:InChI=1/C5H7N3O2/c1-2-10-5(9)4-6-3-7-8-4/h3H,2H2,1H3,(H,6,7,8)
InChI key:DHZYWCBUDKTLGD-UHFFFAOYSA-N
SMILES:CCOC(=O)c1nc[nH]n1
Synonyms:
  • 1H-1,2,4-triazole-3-carboxylic acid, ethyl ester
  • Ethyl 1H-1,2,4-Triazole-3-Carboxylate
Found 4 products.