CAS 6494-81-1

6-chloro-N,N'-diethyl-N-nitroso-1,3,5-triazine-2,4-diamine

Description:

6-Chloro-N,N'-diethyl-N-nitroso-1,3,5-triazine-2,4-diamine, with CAS number 6494-81-1, is a chemical compound that belongs to the class of triazine derivatives. It features a triazine ring, which is a six-membered aromatic heterocycle containing three nitrogen atoms. The presence of the nitroso group (-N=O) and the diethyl substituents contribute to its unique reactivity and potential applications. This compound is characterized by its chlorinated structure, which can influence its chemical stability and reactivity. It may exhibit properties such as being a potential herbicide or pesticide, given the structural motifs common in agrochemicals. Additionally, the presence of the nitroso group suggests potential for nitrosation reactions, which can lead to the formation of various derivatives. Safety and handling precautions are essential, as compounds with nitroso groups can be toxic or carcinogenic. Overall, this compound's specific characteristics and applications would depend on its chemical behavior in various environments and its interactions with biological systems.

Formula: C₇H₁₁ClN₆O

InChI: InChI=1/C7H11ClN6O/c1-3-9-6-10-5(8)11-7(12-6)14(4-2)13-15/h3-4H2,1-2H3,(H,9,10,11,12)

SMILES: CCN=c1nc(Cl)nc([nH]1)N(CC)N=O

Synonyms:

• 1,3,5-Triazine-2,4-diamine, 6-chloro-N,N'-diethyl-N-nitroso-
• 1,3,5-triazine-2,4-diamine, 6-chloro-N~2~,N~4~-diethyl-N~2~-nitroso-
• 6-Chloro-N,N'-diethyl-N-nitroso-1,3,5-triazine-2,4-diamine
• 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl-N2-nitroso-
• 6-Chloro-N2,N4-diethyl-N2-nitroso-1,3,5-triazine-2,4-diaMine
• N-NITROSOSIMAZINE

N-Nitroso Simazine

Controlled Product

CAS: 6494-81-1

Applications A N-nitroso compound of the triazine pesticides Simazine.
References Bakkan, G., et al.: J. Med. Chem., 43, 4534 (2000), Serra, J., et al.: Chem. Res. Toxicol., 14, 1535 (2001),

Formula: C₇H₁₁ClN₆O

Color and Shape: Neat

Molecular weight: 230.65

Ref: TR-N546680