CAS 6495-46-1
:Dioxadrol
Description:
Dioxadrol, with the CAS number 6495-46-1, is a chemical compound that belongs to the class of dioxolanes. It is characterized by its cyclic ether structure, which typically includes two oxygen atoms in a five-membered ring. Dioxadrol is known for its potential applications in various fields, including pharmaceuticals and organic synthesis, due to its unique reactivity and ability to participate in chemical transformations. The compound is generally colorless to pale yellow in appearance and may have a distinctive odor. Its solubility properties often allow it to dissolve in organic solvents, making it useful in various chemical processes. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, dioxadrol's structural features and reactivity make it a compound of interest in both research and industrial applications.
Formula:C20H23NO2
InChI:InChI=1S/C20H23NO2/c1-3-9-16(10-4-1)20(17-11-5-2-6-12-17)22-15-19(23-20)18-13-7-8-14-21-18/h1-6,9-12,18-19,21H,7-8,13-15H2
InChI key:InChIKey=HGKAMARNFGKMLC-UHFFFAOYSA-N
SMILES:C1(OC(CO1)C2CCCCN2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 2,2-Diphenyl-4-(2-piperidyl)-1,3-dioxolane
- 1,3-Dioxolane, 2,2-diphenyl-4-(2'-piperidyl)-
- 2-(2,2-Diphenyl-1,3-dioxolan-4-yl)piperidin [IUPAC]
- Dioxadrol
- Oxadrolum
- Dioxadrol [INN]
- Dioxadrol
- 2-(2,2-Diphenyl-1,3-dioxolan-4-yl)piperidine
- Piperidine, 2-(2,2-diphenyl-1,3-dioxolan-4-yl)-
- 2,2-Diphenyl-4-(2'-piperidyl)-1,3-dioxolane
- 2-(2,2-Diphenyl-1,3-dioxolan-4-yl)piperidin
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
