CAS 64951-04-8

ethyl imidazo[2,1-b][1,3]thiazole-6-carboxylate

Description:

Ethyl imidazo[2,1-b][1,3]thiazole-6-carboxylate is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. Typically, it appears as a solid or crystalline substance and is soluble in polar organic solvents. The presence of the imidazole and thiazole moieties suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various substitution patterns, which can influence its chemical properties and biological interactions. Ethyl imidazo[2,1-b][1,3]thiazole-6-carboxylate may also exhibit fluorescence, making it useful in certain analytical applications. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, further expanding its utility in synthetic chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₈H₈N₂O₂S

InChI: InChI=1/C8H8N2O2S/c1-2-12-7(11)6-5-10-3-4-13-8(10)9-6/h3-5H,2H2,1H3

SMILES: CCOC(=O)c1cn2ccsc2n1

Synonyms:

• Imidazo[2,1-B]Thiazole-6-Carboxylic Acid, Ethyl Ester
• Ethyl imidazo[2,1-b][1,3]thiazole-6-carboxylate

Ethyl imidazo[2,1-b][1,3]thiazole-6-carboxylate

CAS: 64951-04-8

Formula: C₈H₈N₂O₂S

Color and Shape: Solid

Molecular weight: 196.2263

Ref: IN-DA00E99A

Ethyl imidazo[2,1-b][1,3]thiazole-6-carboxylate

CAS: 64951-04-8

Ethyl imidazo[2,1-b][1,3]thiazole-6-carboxylate

Purity: 95%

Color and Shape: Brown Powder

Molecular weight: 196.23g/mol

Ref: 54-OR1447

Ethyl imidazo[2,1-b]thiazole-6-carboxylate

CAS: 64951-04-8

Formula: C₈H₈N₂O₂S

Purity: 95.0%

Molecular weight: 196.22

Ref: 10-F077184