CAS 649559-66-0: 1,2,3,4,5-cyclopentanepentayl, compd. with 1-[(1R)-1-[bis(3,5-dimethylphenyl)phosphino]ethyl]-2-(di-2-furanylphosphino)-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
Description:The chemical substance known as "1,2,3,4,5-cyclopentanepentayl, compd. with 1-[(1R)-1-[bis(3,5-dimethylphenyl)phosphino]ethyl]-2-(di-2-furanylphosphino)-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)" with CAS number 649559-66-0 is a complex organometallic compound. It features a cyclopentane framework that is heavily substituted with phosphine ligands, which are known for their ability to stabilize metal centers and facilitate various catalytic processes. The presence of iron in the structure suggests potential applications in catalysis, particularly in reactions involving organic transformations. The phosphine ligands, including bis(3,5-dimethylphenyl)phosphino and di-2-furanylphosphino groups, enhance the electronic properties of the metal center, influencing its reactivity and selectivity in chemical reactions. This compound may exhibit unique characteristics such as solubility in organic solvents, thermal stability, and specific coordination chemistry, making it of interest in fields like organometallic chemistry and catalysis. Further studies would be necessary to elucidate its precise properties and potential applications.
Formula:C36H36FeO2P2
InChI:InChI=1/C31H31O2P2.C5H5.Fe/c1-21-15-22(2)18-26(17-21)34(27-19-23(3)16-24(4)20-27)25(5)28-9-6-10-29(28)35(30-11-7-13-32-30)31-12-8-14-33-31;1-2-4-5-3-1;/h6-20,25H,1-5H3;1-5H;/t25-;;/m1../s1