CAS 6497-78-5

4-[2-(4-Nitro-1H-imidazol-1-yl)ethyl]morpholine

Description:

4-[2-(4-Nitro-1H-imidazol-1-yl)ethyl]morpholine, with the CAS number 6497-78-5, is a chemical compound characterized by its unique structure that includes a morpholine ring and a nitro-substituted imidazole moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, including moderate solubility in polar solvents due to the presence of the morpholine group, which can engage in hydrogen bonding. The nitro group contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and pharmacology. The imidazole ring is known for its role in biological systems, often participating in enzyme catalysis and acting as a building block for various pharmaceuticals. Additionally, the compound may exhibit antimicrobial or antitumor properties, although specific biological activities would depend on further empirical studies. Overall, 4-[2-(4-Nitro-1H-imidazol-1-yl)ethyl]morpholine represents a versatile structure with potential applications in drug development and research.

Formula: C₉H₁₄N₄O₃

InChI: InChI=1S/C9H14N4O3/c14-13(15)9-7-12(8-10-9)2-1-11-3-5-16-6-4-11/h7-8H,1-6H2

InChI key: InChIKey=VDZAAIIQCHGJAD-UHFFFAOYSA-N

SMILES: C(CN1CCOCC1)N2C=C(N(=O)=O)N=C2

Synonyms:

• 4-[2-(4-Nitro-1H-imidazol-1-yl)ethyl]morpholine
• Morpholine, 4-[2-(4-nitroimidazol-1-yl)ethyl]-
• Morpholine,4-[2-(4-nitroimidazol-1-yl)ethyl]- (7CI,8CI)
• Rgw 611
• Morpholine, 4-[2-(4-nitro-1H-imidazol-1-yl)ethyl]-

RGW 611

CAS: 6497-78-5

Formula: C₉H₁₄N₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 226.2325

Ref: IN-DA00ELH4

RGW 611

CAS: 6497-78-5

RGW 611

Purity: ≥98%

Molecular weight: 226.23g/mol

Ref: 54-BUP11009

RGW 611

CAS: 6497-78-5

RGW 611 is a morpholine derivative that enhances radiation and induces cell death in hypoxic V79-379A cells.

Formula: C₉H₁₄N₄O₃

Purity: 99.24% - 99.41%

Color and Shape: Solid

Molecular weight: 226.23

Ref: TM-T2020

RGW-611

CAS: 6497-78-5

Molecular weight: 226.236

Ref: 10-F986855

Nimorazole Impurity 2

CAS: 6497-78-5

Formula: C₉H₁₄N₄O₃

Molecular weight: 226.24

Ref: ST-EA-CP-N81002