CAS 649758-25-8: (2S,3R,4S,5S,6R)-2-[4-(2-nitroethyl)phenoxy]-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxytetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3,4,5-triol
Description:The chemical substance with the name "(2S,3R,4S,5S,6R)-2-[4-(2-nitroethyl)phenoxy]-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxytetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3,4,5-triol" and CAS number "649758-25-8" is a complex organic compound characterized by its multiple stereocenters and functional groups. It features a tetrahydropyran backbone, which is a six-membered cyclic ether, and is substituted with various hydroxyl groups, indicating it is a polyol. The presence of a nitroethyl group and a phenoxy moiety suggests potential biological activity, possibly as a pharmaceutical agent. The stereochemistry, denoted by the (S) and (R) configurations, indicates specific spatial arrangements of atoms that can significantly influence the compound's reactivity and interaction with biological targets. Such compounds often exhibit unique solubility and stability properties, which are critical for their application in medicinal chemistry. Overall, this substance's intricate structure and functionalization suggest it may have specialized uses in drug development or as a biochemical probe.
Formula:C19H27NO12
InChI:InChI=1/C19H27NO12/c21-11-7-29-18(16(25)13(11)22)30-8-12-14(23)15(24)17(26)19(32-12)31-10-3-1-9(2-4-10)5-6-20(27)28/h1-4,11-19,21-26H,5-8H2/t11-,12-,13+,14-,15+,16-,17-,18+,19-/m1/s1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Thalictricoside REF: BP-BP4057CAS: 649758-25-8 | 95%~99% | To inquire | Tue 22 Apr 25 |

Ref: BP-BP4057
Undefined size | To inquire |