CAS 64976-62-1
:8-methyl-5-nitroquinoline
Description:
8-Methyl-5-nitroquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methyl group at the 8-position and a nitro group at the 5-position contributes to its unique chemical properties. This compound typically appears as a yellow to orange crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The nitro group can participate in electrophilic substitution reactions, while the methyl group can influence the compound's solubility and reactivity. 8-Methyl-5-nitroquinoline may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored for therapeutic purposes. As with many nitro-containing compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with or disposing of this chemical.
Formula:C10H8N2O2
InChI:InChI=1/C10H8N2O2/c1-7-4-5-9(12(13)14)8-3-2-6-11-10(7)8/h2-6H,1H3
SMILES:Cc1ccc(c2cccnc12)N(=O)=O
Synonyms:- Quinoline, 8-Methyl-5-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8-Methyl-5-nitroquinoline
CAS:8-methyl-5-nitroquinoline is a linker that has been shown to be cytotoxic in tumor cells. It binds to DNA by forming covalent bonds and inhibits the synthesis of DNA. 8-methyl-5-nitroquinoline is also able to inhibit the growth of human colon carcinoma cells in vitro and tumor xenografts in vivo. This nitro compound has been shown to cause necrosis, which may be due to its ability to bind oxygen and generate reactive oxygen species. The ability of 8-methyl-5-nitroquinoline to form covalent bonds with DNA makes it a potent antioxidant that may be used for the treatment of radiation injury.Formula:C10H8N2O2Purity:Min. 95%Molecular weight:188.18 g/mol
